find the shaded area ..

Find The Shaded Area ..

Answers

Answer 1

Answer:

39°

Step-by-step explanation:

The angle adjacent to 115° in the lower triangle = 180° - 115° = 65°

angle on circle in lower triangle

= 180° - (65 + 76)°  ← angle sum in triangle

= 180° - 141° = 39°

Angles on the circle subtended from the same arc are congruent, then

shaded angle = 39°


Related Questions

SORRY HELP xx jdjskcksickkwskkdwkkcwo

Answers

Answer:

0

Step-by-step explanation:

zero is not a natural number,it is a whole number

Answer:

0

Step-by-step explanation:

Natural numbers are all positive whole numbers starting at 1 to infinity. So, 0 isn't a natural number.

Evaluate [10/y + 13] -3, when y=5

Answers

Answer:

(10/y+13)-3

(10/5+13)-3

(2+13)-3

15-3

12

I hope this will help you

the diagonal of a square is 50cm long. how long are the sides of the square?

Answers

#1
avatar
+5
The diagonal is the hypotenuese of a Right Triangle, so use the Pythagorean Theorom
a^2 + b^2 = c^2

Since it is a square a = b
so a^2 + a^2 = 50^2
2a^2 = 2500
a^2 =1250
a = 35.355 cm = lenght of a side

Kim asked 40 people how many text messages they each sent on Monday.
The table shows her results.

Number of text messages sent Frequency
0 to 4 6
5 to 9 3
10 to 14 5
15 to 19 12
20 to 24 14
Kim is going to draw a pie chart for this information.

Work out the size of the angle on the pie chart for the sector representing 0 to 4 text messages.

Answers

Answer:

the class and any attachments is intended

Answer:

http://www.bishopstopfords.enfield.sch.uk › ...PDF

Web results

Questions - Bishop Stopfords School

a taxi rider must pay 15000 VND for 1km in the first 10km, when exceeding 10km, they will pay them 14000 VND for each subsequent kilometer.Please write the expression to that the user number must be pay on x km (x>10)

Answers

Answer:

Số tien:S =150000+(x-10)14000

Step-by-step explanation:

<6 and <7 can be classified as?
a. vertical angles
b. alternate interior angles
c. same side interior angles
d. alternate exterior angles

Answers

Answer:

A. vertical angles

Vertical angles are supplementary angles when the lines intersect perpendicularly

find the missing length indicated​

Answers

Answer:

192

Step-by-step explanation:

Apply the geometric mean formula to solve for x, which is the altitude of the right triangle.

The formula is:

h = √(mn)

h = x = ?

m = 144

n = 400 - 144 = 256

Substitute

h = √(256*144)

h = √36,864

h = 192

Therefore, x = 192

How many hundred thousands 90 ten thousands


pls hurry

Answers

Answer:

0.9

Step-by-step explanation:

100,000 in 90,000

Help Pls if you want!!!!

Answers

Answer:

Its 2.5 percent ladd enjoy

Step-by-step explanation:

Answer:

2 per team and 2 left

Step-by-step explanation:

10 can't split into 4 evenly so, you can only give 2 to each team causing there to be 2 left.

4*2 = 8

10-8 = 2

Please help I’ll give brainliest if you explain.

Answers

Answer:

B

Step-by-step explanation:

there are four girls in total, and Martina is most probably a girl too. only 1 girl out of the four girls will be chosen so probability is 1/4

Put the steps In order

Answers

1-4-2-3……………….don’t understand these 20 character limits

From the diagram below, you can say that the two triangles are
Select one:
Congruent by SAS
Not Congruent
Congruent by HL
Congruent ASA

Answers

Answer:

C

Step-by-step explanation:

As the legs and hypotenuse are same, these triangles are congruent by HL congruency

A submarine cruises underwater at 20 km/h and on
the surface at 30 km/h. The submarine travels a.
distance of 650 km in 25 h. A linear system was
created and graphed

Answers

Answer:

System of equations:

20x + 30y = 650

x + y = 25

Time underwater = 10 hours

Time at the surface = 15 hours

Step-by-step explanation:

Let x = time underwater at 20 km/h.

Let y = time on the surface at 30 km/h.

speed = distance/time

distance = speed * time

distance underwater: 20x

distance on the surface: 30y

total distance: 650

20x + 30y = 650

total time: x + y

total time: 25

x + y = 25

20x + 30y = 650

x + y = 25

20x + 30y = 650

-20x - 20y = -500

--------------------------------

          10y = 150

              y = 15

x + y = 25

x + 15 = 25

x = 10

True or false? Any two points are collinear and coplanar

Answers

Answer:

True

Step-by-step explanation:

Any two points are always collinear because you can always connect them with a straight line. Three or more points can be collinear, but they don't have to be. ... Coplanar points: A group of points that lie in the same plane are coplanar. Any two or three points are always coplanar.

Please hurry I will mark you brainliest
What is the value of p so that the line passing through (6, 2) and (9, p) has a slope of -1?

Answers

Answer:

-1

Step-by-step explanation:

im pretty sure its right

sry if it not good luck!!

Stella has five times as many books as Tina. If Stella gave 16 books to Tina, they would each have the same number of books. How many books does Stella have? ​

Answers

Answer:

40 books

Step-by-step explanation:

s = Stella's books

t = Tina's books

Given:

s = 5t

s - 16 = t + 16

Plug first equation into second:

5t - 16 = t + 16

4t = 32

t = 8 books

s = 5t = 40 books

((Check: 40 - 16 = 24 = 8 + 16 ✔ ))

factorise 1000a^2+27b^2​

Answers

1000a+27b with 2 on top of the number

[tex](a+b)^{2}[/tex]

Answers

Answer:

[tex] ({a + b})^{2} [/tex]

[tex](a + b)(a + b)[/tex]

[tex] {a}^{2} + 2ab + {b}^{2} [/tex]

hope this help you

Select the best answer to describe the parabola

Answers

Answer:

B

Step-by-step explanation:

It opens downwards, so the parabola is negative. This also means the vertex of the parabola is the highest point, therefore it is a maximum.

#1 with work please

Answers

Answer:

-19

Step-by-step explanation:

5v+3w

Let v = -5 and w=2

5(-5) + 3(2)

Multiply first

-25 + 6

The add

-19

1. Evaljate 5v +3w for v = -5 and w = 2

plug-in

5(-5) +3(2)

-25 +6

Answer: -19

2. Simplify the expression 8(e -1) + 2(e -1)

Distribute

8(e -1) + 2(e -1)

8e -8 + 2e -2

10e -10

Answer:  10e -10

translation geometry please help!! Acellus

Answers

Answer:

A' (-6,3)

B' (-3,0)

C' (-7,1)

Answered by GAUTHMATH

Answer:

A -6, 3

C -7 1

B -3,0

Step-by-step explanation:

Someone please help me!!!

Answers

Answer:

<2 = 75°

<3 = 75°

Step-by-step explanation:

<2 = <6

2x+15 = 45+x

or, 2x-x = 45-15

or, x = 30

so, <2 = 30×2+15 = 75

<6 = 45+30 = 75

Answered by GAUTHMATH

4over6=24over16 explain the error in the students work

Answers

Step-by-step explanation:

The key to solve this problem is using ratios and proportions.

The key to solve this problem is using ratios and proportions.Ratio is the relationship between two numbers, defined as the quotient of one number for the other. So: The ratio between two numbers a and b is the fraction a/b and it is read a to b. This reason can also be written a : b.

The key to solve this problem is using ratios and proportions.Ratio is the relationship between two numbers, defined as the quotient of one number for the other. So: The ratio between two numbers a and b is the fraction a/b and it is read a to b. This reason can also be written a : b.Given two reasons a/b and c/d we say that they are in proportion if a/b = c/d. The terms a and d are called extremes while b and c are the means. In every proportion the product of the extremes is equal to the product of the means: a.d = b.c

The key to solve this problem is using ratios and proportions.Ratio is the relationship between two numbers, defined as the quotient of one number for the other. So: The ratio between two numbers a and b is the fraction a/b and it is read a to b. This reason can also be written a : b.Given two reasons a/b and c/d we say that they are in proportion if a/b = c/d. The terms a and d are called extremes while b and c are the means. In every proportion the product of the extremes is equal to the product of the means: a.d = b.cA student uses the ratio of 4 oranges to 6 fluid ounces of juice to find the numbers of oranges needed to make 24 fluid ounces of juice.

The key to solve this problem is using ratios and proportions.Ratio is the relationship between two numbers, defined as the quotient of one number for the other. So: The ratio between two numbers a and b is the fraction a/b and it is read a to b. This reason can also be written a : b.Given two reasons a/b and c/d we say that they are in proportion if a/b = c/d. The terms a and d are called extremes while b and c are the means. In every proportion the product of the extremes is equal to the product of the means: a.d = b.cA student uses the ratio of 4 oranges to 6 fluid ounces of juice to find the numbers of oranges needed to make 24 fluid ounces of juice.

The key to solve this problem is using ratios and proportions.Ratio is the relationship between two numbers, defined as the quotient of one number for the other. So: The ratio between two numbers a and b is the fraction a/b and it is read a to b. This reason can also be written a : b.Given two reasons a/b and c/d we say that they are in proportion if a/b = c/d. The terms a and d are called extremes while b and c are the means. In every proportion the product of the extremes is equal to the product of the means: a.d = b.cA student uses the ratio of 4 oranges to 6 fluid ounces of juice to find the numbers of oranges needed to make 24 fluid ounces of juice. The error in the student's work was that they reversed the reason, 24/16 instead of 16/24.

I need help to find x=

Answers

Answer:

x=12

Step-by-step explanation:

Since the polygons are similar, we can write a ratio to solve

red side / yellow side

4      2

--- = ---

x       6

Using cross products

4*6 = 2x

24 = 2x

Divide by 2

24/2 =2x/2

12=x

Answer:

12

Step-by-step explanation:

When two shapes are similar, you need to find the scale factor of two existing corresponding sides.

For example, you can do 6 and 2.

Divide:

6/2 = 3

The scale factor: 3

Now multiply 4 and the scale factor (3):

4 × 3 = 12

So, x = 12.

Hope this helped.

what is 2/3 divide by 2/9

Answers

Answer:

3

Step-by-step explanation:

(2/3)/(2/9) = (2/3) * (9/2) = 3

I need help plz help

Answers

We know

[tex]\boxed{\sf cos\Theta=\dfrac{b}{h}}[/tex]

[tex]\\ \sf\longmapsto cos22=\dfrac{x}{47}[/tex]

[tex]\\ \sf\longmapsto 0.9=\dfrac{x}{47}[/tex]

[tex]\\ \sf\longmapsto x=47(0.9)[/tex]

[tex]\\ \sf\longmapsto x=42.3[/tex]

does anybody know the answer?

Answers

The correct answer is A. The second term is 3*7 - 6 = 15

Find f(-1) when f(x) = x 2 - 5x - 3

Answers

Answer:

f(- 1) = 3

Step-by-step explanation:

To evaluate f(- 1) substitute x = - 1 into f(x) , that is

f(- 1) = (- 1)² - 5(- 1) - 3 = 1 + 5 - 3 = 3

Answer:

Step-by-step explanation:

f(-1)  =(- 1)^2 - 5.(-1) - 3 = 3

If APQR = ASTU, complete each blank below with the appropriate length or measure.

Answers

Answer:

ST = 8 m

SU = 7 m

m∠Q = 75°

m∠S = 59°

m∠R = 46°

m∠U = 46°

Step-by-step explanation:

The given parameter are;

ΔPQR is congruent to ΔSTU

In ΔPQR, m∠P = 59°, PR = 8 m, PQ = 7 m

In ΔSTU, m∠T = 75°

By Side-Angle-Side rule of congruence, and given that m∠P ≠ m∠T, we can have;

m∠S ≅ m∠P, by Congruent Parts of Congruent Triangles are Congruent, CPCTC

ST ≅ PR, SU ≅ PQ, m∠Q ≅ m∠T, m∠U ≅ m∠R

Therefore;

ST = PR = 8 m

ST = 8 m

SU = PQ = 7 m

SU = 7 m

m∠Q = m∠T = 75°

m∠Q = 75°

m∠S = m∠P = 59°

m∠S = 59°

m∠U = m∠R = 180 - (75° + 59°) = 46°

m∠R = 46°

m∠U = 46°.

Can someone help with number 4 please? Due in 15 mins!!

Answers

Answer:

A. AG = 2 × GD

F. GE = (1/2) × BG

Step-by-step explanation:

The given point G on triangle ΔABC, which is the point of intersection of the medians of the triangle, is the centroid of the triangle

The centroid divides each median line in the ratio 2:1, therefore, we have;

The length of AG = 2 × GD, CG = 2 × GF, and BG = 2 × GE

∴ GE = (1/2) × BG

Therefore, the correct options are;

A. AG = 2 × GD, and F. GE = (1/2) × BG

Other Questions
In the late nineteenth century, a number of people from European countries moved to the United States. The act of moving to one nation from another is called . BOYS AND GIRLS, HELP ME PLEASE!!5,6,7,8 PLEASEfactor this examples Calculate the numerical value of the equilibrium constant, Kc, for the reaction below if the equilibrium concentrations for CO, H2 , CH4 and H2O are 0.989 M, 0.993 M, 1.078 M and 0.878 M, respectively. (calculate your answer to three sig figs)CO(g) + 3 H2(g) CH4(g) + H2O(g) Which of the following statements is False. A. Correlational research can be used to study naturally occurring variables.B. Correlations tell researchers about the strength and direction of relationships between variables C. Correlations can be used to establish cause-and- effect relationships between variables D. Correlational research can be conducted either in the laboratory or in the field Enter the solutions from least to greatest.f(x) = (x 3)(2x 8) How many electrons will one atom of element with 6 protons and 9 neutrons . give an explanation of tundra sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Is velocity ratio of a machine affected by applying oil on it?Explain with reason. rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible Complete the table to investigate dilations ofexponential functions.3.2*23x-2NAN62-12 / 0ab1d.ef241264a =bef=d =DONEIntro What are three things that all 50 state governments have in common? 18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?acuteobtuseequiangularright How do feedback mechanisms help maintain homeostasis? The pre-australopith fossils are especially significant because they challenge some of the long-standing explanations of our evolutionary history. Describe two reasons the pre-australopiths force us to rethink the savanna hypothesis in particular. (Hint: Think about the anatomical traits of the pre-australopiths and the environmental and temporal context in which they lived.) The decomposition of ammonia is: 2 NH3(g) N2(g) + 3 H2(g). If Kp is 1.5 103 at 400C, what is the partial pressure of ammonia at equilibrium when N2 is 0.20 atm and H2 is 0.15 atm? What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid? Many immigrants at the turn of the twentieth century came to the United States to escape religious persecution in their homelands. This is an example of what concept?assimilationpush-pull factorcultural shocknativism Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later How would the following triangle be classified?O scalene acuteO scalene obtuseO isosceles acuteO isosceles obtuse