need help asap (giving brainliest)

Need Help Asap (giving Brainliest)

Answers

Answer 1

Answer:

hhhhjhgbbbjjhjjjjjkkkkkkkk

Answer 2

Answer:

Step-by-step explanation:

Q1. Sobey's is the best deal

In Food Basics, having the two loaves of bread costing 4.88 would mean that (4.88 / 2) one would cost 2.44.

To find out how much three would cost, multiply 2.44 by three, and the result is 7.32, which is higher than the three loves of bread that costs 7.20 in Sobey's, which Sobey's has a better deal. 7.20 / 3 = 2.40, yet Food Basics does cost higher by 4 cents for just one.

I am not too sure about question 2, but I do hope the above question helps!


Related Questions

1. You are given the 3rd and 5th term of an arithmetic sequence. Describe in words how to determine the general term.

2. You are given the 3rd and 5th term of an geometric sequence. Describe how to determine the 10th term without finding the general term.

Answers

Step-by-step explanation:

1. In an arithmetic sequence, the general term can be written as

xₙ = y + d(a-1), where xₐ represents the ath term, y is the first value, and d is the common difference.

Given the third term and the fifth term, and knowing that the difference between each term is d, we can say that the 4th term is x₃+d and the fifth term is the fourth term plus d, or (x₃+d)+d =

x₃+2d. =x₅ Given x₃ and x₅, we can subtract x₃ from both sides to get

x₅-x₃ = 2d

divide by 2 to isolate d

(x₅-x₃)/2 = d

This lets us solve for d. Given d, we can say that

x₃ = y+d(2)

subtract 2*d from both sides to isolate the y

x₃ -2*d = y

Therefore, because we know x₃ and d at this point, we can solve for y, letting us plug y and d into our original equation of

xₙ = y + d(a-1)

2.

Given the third and fifth term, with a common ratio of r, we can say that the fourth term is x₃ * r. Then, the fifth term is

x₃* r * r

= x₃*r² = x₅

divide both sides by x₃ to isolate the r²

x₅/x₃ = r²

square root both sides

√(x₅/x₃) = ±r

One thing that is important to note is that we don't know whether r is positive or negative. For example, if x₃ = 4 and x₅ = 16, regardless of whether r is equal to 2 or -2, 4*r² = 16. I will be assuming that r is positive for this question.

Given the common ratio, we can find x₆ as x₅ * r, x₇ as x₅*r², and all the way up to x₁₀ = x₅*r⁵. We don't know the general term, but can still find the tenth term of the sequence

GIVING 25 POINTS AND BRAINIER IF ANSWERED!

What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.

Answers

The answer to your question is A

Answer:

B. The question may not be directly stated.

Help me! Thanks!!!!!!

Answers

Answer:

there are infinite solutions

Step-by-step explanation:

if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system

18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?

acute

obtuse

equiangular

right

Answers

Answer:

obtuse                    

aniuhafjhnfajfnha

The function below models the correlation between the number of hours a plant is kept in sunlight (x) and the height (y), in mm, to which it grows: y = 2 + 4x What does the y-intercept of this function represent? (1 point) The original height of the plant was 4 mm. The original height of the plant was 2 mm. The height of the plant increases by 2 mm for every hour of sunlight it receives. The height of the plant increases by 4 mm for every hour of sunlight it receives.

Answers

Answer:

The original height of the plant was 2 mm

Step-by-step explanation:

Given

[tex]y = 2 + 4x[/tex]

Required

Interpret the y-intercept

The y-intercept is when [tex]x = 0[/tex]

So, we have:

[tex]y = 2 + 4 *0[/tex]

[tex]y = 2 + 0[/tex]

[tex]y = 2[/tex]

This implies that the original or initial height was 2 mm

sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?

Answers

Answer:

17 units

Step-by-step explanation:

Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

Plug in the points and simplify:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]

[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]

[tex]d = \sqrt{225 + 64[/tex]

[tex]d = \sqrt{289[/tex]

[tex]d = 17[/tex]

So, the distance between the points is 17 units

How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse

Answers

Answer:

isosceles acute

Step-by-step explanation:

We have two sides that are equal so the triangle is isosceles

None of the angles are larger than 90 degrees so non of the angles are obtuse,  and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)

rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible​

Answers

= 2025

When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)

For this, you divide the given lengths using the numbers that divides all through.

I have added an image to this answer. Go through it for more explanation

.
.
.
.
.
.
.
.
.
.
.
“””” HELP PLEASE “”””
.
.
.
.
.
.
.
.
.
.
.

Answers

9514 1404 393

Answer:

  x = 14 cm

Step-by-step explanation:

We can only solve for x if the triangles are similar. The arrows on the left and right legs say those are parallel. Since alternate interior angles at each of the transversals are congruent, the triangles are AA similar.

ΔABC ~ ΔDEC, so we have ...

  EC/ED = BC/BA

  x/(18 cm) = (35 cm)/(45 cm)

  x = (18 cm)(7/9) = 14 cm

–20 ÷ 5 =

I need help

Answers

The answer is -4
-20 divided by 5 ^

A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.

Answers

Answer:

C

Step-by-step explanation:

find the equation of straight line passes through point (3,1) such that the intercept on y-axis exceeds that on the x- axis by 4.



Answers

Answer:

Step-by-step explanation:


I need help answering this ASAP

Answers

Answer:

A

Step-by-step explanation:

The graph is a square root function

Which of the following questions are equivalent to the answer below x 3/5

Answers

Answer:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex]

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex]

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex]

Step-by-step explanation:

Given

[tex]x^\frac{3}{5}[/tex]

Required

The equivalent expressions

We have:

[tex]x^\frac{3}{5}[/tex]

Expand the exponent

[tex]x^\frac{3}{5} = x^{ 3 * \frac{1}{5}}[/tex]

So, we have:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex] ----- this is equivalent

Express 1/5 as roots (law of indices)

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex] ------ this is equivalent

The above can be rewritten as:

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex] ------ this is equivalent

Assume a researcher wants to compare the mean Alanine Aminotransferase (ALT) levels in two populations, individuals who drink alcohol and individuals who do not drink alcohol. The mean ALT levels for the individuals who do not drink alcohol is 32 with a standard deviation of 14, and 37 individuals were in the sample. The mean ALT levels for individuals who drink alcohol is 69 with a standard deviation of 19, and 38 individuals were in the sample. Construct and interpret a 95% confidence interval demonstrating the difference in means for those individuals who drink alcohol when compared to those who do not drink alcohol.
a. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.22 and 39.78.
b. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.33 and 39.67
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
d. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.41 and 39.59.

Answers

Answer:

c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.

Step-by-step explanation:

Given :

Groups:

x1 = 69 ; s1 = 19 ; n1 = 38

x2 = 32 ; s2 = 14 ; n2 = 37

1 - α = 1 - 0.95 = 0.05

Using a confidence interval calculator to save computation time, kindly plug the values into the calculator :

The confidence interval obtained is :

(24.32 ; 39.68) ; This means that we are 95% confident that the true mean difference in ALT values between the two population lies between

(24.32 ; 39.68) .

Use the integral test to determine whether the series is convergent or divergent. [infinity] n = 2 n2 n3 + 1 Evaluate the following integral. [infinity] 2 x2 x3 + 1 dx

Answers

I think the given series is

[tex]\displaystyle\sum_{n=2}^\infty \frac{n^2}{n^3+1}[/tex]

You can use the integral test because the summand is clearly positive and decreasing. Then

[tex]\displaystyle\sum_{n=2}^\infty\frac{n^2}{n^3+1} > \int_2^\infty\frac{x^2}{x^3+1}\,\mathrm dx[/tex]

Substitute u = x ³ + 1 and du = 3x ² dx, so the integral becomes

[tex]\displaystyle \int_2^\infty\frac{x^2}{x^3+1}\,\mathrm dx = \frac13\int_9^\infty\frac{\mathrm du}u = \frac13\ln(u)\bigg|_{u=9}^{u\to\infty}[/tex]

As u approaches infinity, we have ln(u) also approaching infinity (whereas 1/3 ln(9) is finite), so the integral and hence the sum diverges.

You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.

Answers

Answer:

[tex]35.36,44.64[/tex]

Step-by-step explanation:

Sample size [tex]n=40[/tex]

Mean weight [tex]\=x =67[/tex]

Standard deviation [tex]\sigma=11.4[/tex]

Confidence Interval [tex]CI=0.99[/tex]

\alpha==0.01

Therefore

[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]

From table

[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]

Generally, the equation for Margin of error is mathematically given by

[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]

[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]

[tex]M.E=4.64[/tex]

Therefore Estimated mean is

[tex]\=x-M.E<\mu <\=x +E[/tex]

[tex]40-4.64<\mu< 40+4.64[/tex]

[tex]35.36<\mu < 44.64[/tex]

[tex]35.36,44.64[/tex]

Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)

Answers

Answer:

The zeroes of the function are: 3 and 4

Step-by-step explanation:

The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem

dN/dt = N(1 − 0.0008N), N(0) = 1.

Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?

Answers

Answer:

1250 supermarkets

Step-by-step explanation:

Given

[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]

[tex]N(0) = 1[/tex]

Required

Number of supermarkets over a long period of time

To do this, we simply set

[tex]\frac{dN}{dt} = 0[/tex]

So, we have:

[tex]N(1 - 0.0008N) = 0[/tex]

Split

[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]

Solve: [tex]1 - 0.0008N = 0[/tex]

Collect like terms

[tex]0.0008N = 1[/tex]

Make N the subject

[tex]N = \frac{1}{0.0008}[/tex]

[tex]N = 1250[/tex]

So:

[tex]\lim_{t \to \infty} N(t) = 1250[/tex]

What is the value of x in the equation 5(3x + 4) = 23?

Answers

Answer:

x = 1/5

Step-by-step explanation:

5(3x + 4) = 23

Distribute

15x+20 = 23

Subtract 20 from each side

15x+20-20 = 23-20

15x = 3

Divide by 15

15x/15 = 3/15

x = 1/5

Answer:

[tex]x = 0.2[/tex]

Step-by-step explanation:

Step 1:  Distribute

[tex]5(3x + 4) = 23[/tex]

[tex](5 * 3x) + (5 * 4) = 23[/tex]

[tex](15x) + 20 = 23[/tex]

Step 2:  Subtract 20 from both sides

[tex](15x) + 20 - 20 = 23 - 20[/tex]

[tex]15x = 3[/tex]

Step 3:  Divide both sides by 15

[tex]\frac{15x}{15} = \frac{3}{15}[/tex]

[tex]x = \frac{1}{5}[/tex]

[tex]x = 0.2[/tex]

Answer:  [tex]x = 0.2[/tex]

a coin is tossed succesively three times times . determine tje probabiliy of getting all three heads​

Answers

Answer:

Answer : 1/8.

Step-by-step explanation:

Hey there!

Please see the attached picture for your answer.

Hope it helps!

Please send only answer
Want to bring a metal rod to assemble a toy frame. All long metal rods must be used at least. How much to assemble the frame as shown in the picture

Answers

Answer:

how many times should u use the metal rod ??

Two chords in a circle intersect. One chord is made of 6 and 5, and the other is made of x +1 and x. What is x?

Answers

Answer:

x = 5 and -6

Step-by-step explanation:

Using the intersecting chord theorem which states that the products of the lengths of the line segments on each chord are equal.

Hence:

let

a = 6, b = 5, c = x+1 and d = x

Therefore, ab = cd

6*5 = x(x+1)

30 = x²+x

x²+x - 30 = 0

x²+ 6x - 5x - 30 = 0

x(x+6) - 5(x+6) =0

(x-5)(x+6) = 0

x-5 =0 and x+6 = 0

x = 5 and -6

PLEASE HELP ASAP!!!!!

Answers

Step-by-step explanation:

Area ABC=1/2ab×sin C

=1/2 ×20×10 ×Sin C

Sin C =100

Trucks in a delivery fleet travel a mean of 120 miles per day with a standard deviation of 23 miles per day. The mileage per day is distributed normally. Find the probability that a truck drives less than 159 miles in a day. Round your answer to four decimal places.

Answers

Answer:

the probability that a truck drives less than 159 miles in a day = 0.9374

Step-by-step explanation:

Given;

mean of the truck's speed, (m) = 120 miles per day

standard deviation, d = 23 miles per day

If the mileage per day is normally distributed, we use the following conceptual method to determine the probability of less than 159 miles per day;

1 standard deviation above the mean = m + d, = 120 + 23 = 143

2 standard deviation above the mean = m + 2d, = 120 + 46 = 166

159 is below 2 standard deviation above the mean but greater than 1 standard deviation above the mean.

For normal districution, 1 standard deviation above the mean = 84 percentile

Also, 2 standard deviation above the mean = 98 percentile

143 --------> 84%

159 ---------> x

166 --------- 98%

[tex]\frac{159-143}{166-143} = \frac{x-84}{98-84} \\\\\frac{16}{23} = \frac{x-84}{14} \\\\23(x-84) = 224\\\\x-84 = 9.7391\\\\x = 93.7391\ \%[/tex]

Therefore, the probability that a truck drives less than 159 miles in a day = 0.9374

Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later

Answers

Answer:

The rate at which the distance between the two cars is increasing is 30 mi/h

Step-by-step explanation:

Given;

speed of the first car, v₁ = 24 mi/h

speed of the second car, v₂ = 18 mi/h

Two hours later, the position of the cars is calculated as;

position of the first car, d₁ = 24 mi/h  x 2 h  = 48 mi

position of the second car, d₂ = 18 mi/h  x 2 h = 36 mi

The displacement of the two car is calculated as;

displacement, d² = 48² + 36²

                        d² = 3600

                        d = √3600

                        d = 60 mi

The rate at which this displacement is changing = (60 mi) / (2h)

                                                                                 = 30 mi/h

Help please ….. help

Answers

Answer:

Step-by-step explanation:

a) categorical

b) add all of the numbers and divide by how many numbers there were.

c) outliers means any that were far away from the rest of the data

d) not entirely, you can make an estimate based on it, but nat an exact answer.

Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.

Answers

X - Y = 36 -> X = 36+ Y
3X + 2Y = 48 -> 3(36+Y)+2Y= 48-> Y = -12
X = 36-12= 24
X -2Y= 24-2.(-12) = 48

find the missing side length below brainly

Answers

Let it be x

[tex]\\ \sf\longmapsto \dfrac{3}{5}=\dfrac{x}{x+4}[/tex]

[tex]\\ \sf\longmapsto 3(x+4)=5x[/tex]

[tex]\\ \sf\longmapsto 3x+12=5x[/tex]

[tex]\\ \sf\longmapsto 5x-3x=12[/tex]

[tex]\\ \sf\longmapsto 2x=12[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{12}{2}[/tex]

[tex]\\ \sf\longmapsto x=6[/tex]

Other Questions
PLS HELP Leo is looking at two different savings plans. The first plan requires an initial deposit of $500 and grows at an annual interest rate of 2.5%. The second plan requires an initial deposit of $400 and interest grows continuously at a rate of 2% per year. Leo wrote a system of equations to represent the account balance of either plan, y, after x years. Which two equations are part of the system? OPTIONS ARE BELOW Suppose that you have a block of copper which is 300 g. Relevant material parameters follow. Material atomic weight Density Copper 63.5 g/mol 8.96 g/cm^3 Using equipartition, compute the molar heat capacity in J/mol K. A plaintiff sued a defendant in a patent infringement suit. To sustain his claim, the plaintiff was required to demonstrate the formula for a common chemical compound. The plaintiff produced three well-known chemistry texts containing explanations of the formula and asked the court to take judicial notice of the formula for the compound. Must the trial judge take judicial notice of the formula Mariah owed her grandfather 52.25 but was recently able to pay him back $1.50. How much does Mariah currentlyowe her grandfather? Please answer this given question below.... please describe the role of enzymes in seeds germination You are working from home using a microcomputer, a DSL modem, and a telephone connection to the Internet. Your company is connected to the Internet and has both local area networks and a mainframe computer. List all the different network connections involved in this operation. Language and Editing - Domain TestCan I get the answers for 1-20 A PCP might use social media to report laboratory results to a patient. Architects and builders were brought to Timbuktu to build In a project schedule, the sequence of activities which cannot be delayed during the course of the project without extending the project end date is referred to as the: - sapno ke se din A saturated solution of potassium iodide contains, in each 100 mL, 100 g of potassium iodide. The solubility of potassium iodide is 1 g in 0.7 mL of water. Calculate the specific gravity of the saturated solution Which structures develop in the fetus during the first trimester of pregnancy? Check all that apply. brain spine genitals moles prefix in word underestimate means which of the following ? a) in b) below c) above d) around The presence of which gas makes the planets Uranus and Neptune appear blue?a. heliumb. hydrogenc. methaned. nitrogen How many moles of air are in a hot- air balloon with a volume of 2200m ^ 3 at a temperature of 388 K and a pressure of 100 kPa? Hallar el noveno trmino de la progresin aritmtica 8, 13, 18, Write a letter to your brother who is in uproad Asking him to send a mobile phone Complete the sequence of numbers in this set. Explain the pattern.7.5, 6.25, 5, ___, ___