The expression for K3 = 1K1×1K2 when the chemical equations and equilibrium expressions for two reactions at the same temperature are given.
A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. For a reaction like aA -> A, the rate law frequently takes the form rate = k[A]n, where k is the proportionality constant known as the rate constant and n is the order of the reaction.
Given the reactions as:
CO(g)+3H2(g)⇄CH4(g)+H2O(g)
the rate law for the above equation is (K1) = [CH4][H2O]/[CO][H2]^3
Then [H2]^3 = [CH4][H2O]/K1[CO]
CO2(g)+H2(g)⇄CO(g)+H2O(g)
the rate law for the above equation is (K2) = [CO][H2O]/[CO2][H2]
[CO2] = [CO][H2O]/K2[H2]
CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)
Similarly the rate law for the above equation is (K3) = [CO2][H2]^4/[CH4][H2O]^2
Then K3 = [CO][H2][CH4][H2O][H2O]/K2[H2]K1[CO]
Then K3 = 1K1×1K2
To learn more about equilibrium click here https://brainly.com/question/29359391
#SPJ4
complete question: Reaction 1:CO(g)+3H2(g)⇄CH4(g)+H2O(g), K1=[CH4][H2O][CO][H2]3 . Reaction 2:CO2(g)+H2(g)⇄CO(g)+H2O(g), K2=[CO][H2O][CO2][H2]. Reaction 3:CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)then K3=?
The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3 for reaction 3 at the same temperature?
two tablets of the antibiotic isoniazid were crushed, dissolved, and homogenized in 100 ml of water. the solution was then assayed using redox titration. given the equation below, if 12.16 ml of 0.020 m kbro3 was required to reach the endpoint, how many mg of isoniazid were present in each isoniazid tablet? (note: mw of isoniazid
Dosage for an isoniazid and rifapentine combo regimen administered in 12 once-weekly doses while being closely monitored for the treatment of latent Mycobacterium tuberculosis infection. There are 100 mg and 300 mg tablets available of isoniazid (INH).
How much Isoniazid is the MG?Depending on the schedule that your doctor determines for you, the typical dose is 10 to 20 mg per kg (4.5 to 9.1 mg per pound) of body weight, up to 300 mg, once a day; or 20 to 40 mg per kg (9.1 to 18.2 mg per pound) of body weight, up to 900 mg, twice a week; or three times a week.Dosage for an isoniazid and rifapentine combo regimen administered in 12 once-weekly doses while being closely monitored for the treatment of latent Mycobacterium tuberculosis infection. There are 100 mg and 300 mg tablets available of isoniazid (INH).To learn more about isoniazid refer to:
https://brainly.com/question/23790674
#SPJ4
What following actions are permitted in balancing a chemical equation?
-Multiplying all coefficients by a common factor
- Inserting coefficients and front of formulas of reactants and products
The actions that aren't permitted in balancing a chemical equation is given below.
What is chemical equation?A chemical equation is an expression that represents the chemical reaction between two or more substances. It consists of the chemical formulas of the reactants (the starting materials) and the products (the end result of the reaction), along with the physical states of the reactants and products (solid, liquid, gas, etc.) and the symbols that denote the type of reaction that is taking place (e.g. double arrow for a reversible reaction). The number of atoms of each element in the reactants and products must be the same on both sides of the equation.
Multiplying all coefficients by a common factor
- Inserting coefficients and front of formulas of reactants and products to balance the equation
- Adding coefficients in front of formulas of reactants and products to balance the equation
- Ignoring common elements in the equation
- Using the law of conservation of mass to balance the equation
- Combining like terms on both the reactants and products side of the equation
- Splitting a compound into its constituent elements with their respective coefficients
- Cancelling out any coefficients that are equal on both sides of the equation
- Rearranging terms to obtain the desired balance
- Substituting coefficients until the equation is balanced
- Checking the equation after balancing to verify that all atoms are balanced on both sides of the equation.
To know more about chemical equation click-
https://brainly.com/question/26487468
#SPJ4
an ideal gas is cooled from 100 c to -43 c in a sealed container while maintaining a constant pressure. which of the following statements are true?
The volume of the gas decreases as it is cooled, while maintaining a constant pressure.
What is pressure?
Pressure is defined as the force exerted per unit area. It is a scalar quantity and is measured in units of force per unit area, such as pascals (Pa) or pounds per square inch (psi). Pressure can be exerted by a gas, liquid, or solid on a surface, and it can be exerted in any direction. It is the ratio of force to the area over which that force is distributed. This means that a small force exerted over a large area will have the same pressure as a larger force exerted over a smaller area.
When an ideal gas is cooled from 100°C to -43°C at a constant pressure, the temperature decreases and the volume of the gas decreases. This is because the gas molecules lose energy and move slower, which means they take up less space.
The ideal gas law, PV = nRT, states that the product of pressure and volume is directly proportional to the number of moles of gas and the absolute temperature. As the temperature decreases and the pressure remains constant, the volume of the gas decreases.
The other statements are not true:
-The number of moles of gas decreases as it is cooled.
-The pressure of the gas decreases as it is cooled.
-The number of gas molecules decreases as it is cooled.
As long as the volume is kept constant and the temperature is lowered, the pressure of the gas decreases.
To learn more about pressure from the given link:
https://brainly.com/question/25736513
#SPJ4
2 BaO2(s) ⇄ 2 BaO(s) + O2(g)
ΔH° = 162 kJ/molrxn
A sealed rigid vessel contains BaO2(s) in equilibrium with BaO(s) and O2(g) as represented by the equation above.
Which of the following changes will increase the amount of BaO2(s) in the vessel?
(A)Removing a small amount of O2(g)
(B) Removing a small amount of BaO(s)
(C) Adding He gas to the vessel
(D) Lowering the temperature
'Removing a small amount of O2(g)' will increase the amount of BaO2(s) in the vessel.
What do you mean by a vessel?
In chemistry, a vessel is a container, typically made of glass, that is used to hold and heat liquids or solids in a chemical reaction. It is an essential piece of laboratory equipment, and it is used to safely and accurately measure, mix, and store materials. Vessels come in many different forms and sizes, and are used for everything from simple mixing applications to complex, high-temperature reactions.
When oxygen is removed from the vessel, the equilibrium of the reaction will shift in favor of the formation of BaO2(s). This is because the reaction is exothermic and the decrease in O2(g) will reduce the amount of energy available for the reaction to occur, thus favoring the formation of BaO2(s).
Hence, option A is correct.
To know more about vessel,
https://brainly.com/question/29026201
#SPJ4
select all the reactions in which the oxidation numbers of the reactant species change, that is, are redox reactions.
The redox reactions are: a) 7O₂ (g) + 2C₂H₆ (l) → 4CO₂ (g) + 6H₂O (l) & c) Cu(OH)₂ (s) + 2HClO₄ (aq) → Cu(ClO₄)₂ (aq) + H₂O (l).
a) 7O₂ (g) + 2C₂H₆ (l) → 4CO₂ (g) + 6H₂O (l) is a redox reaction. Oxygen is gaining electrons and becoming reduced (from O₂ to H₂O) while the carbon in the C₂H₆ is losing electrons and becoming oxidized (from C₂H₆ to CO₂).
b) Co (s) + Cl₂ (g) → CoCl₂ (s) is not a redox reaction, as the oxidation numbers of cobalt and chlorine remain the same on both sides of the equation.
c) c) Cu(OH)₂ (s) + 2HClO₄ (aq) → Cu(ClO₄)₂ (aq) + H₂O (l) is a redox reaction. Copper is losing electrons and becoming oxidized (from Cu(OH)₂ to Cu(ClO₄)₂) while the chlorine in the HClO₄ is gaining electrons and becoming reduced (from ClO₄ to Cl).
d) ZnBr₂ (aq) + 2KOH (aq) → Zn(OH)₂ (s) + 2KBr (aq) is a redox reaction. Zinc is losing electrons and becoming oxidized (from ZnBr₂ to Zn(OH)₂) while the Hydrogen in the KOH is gaining electrons and becoming reduced (from KOH to KBr).
Learn more about redox reactions at
https://brainly.com/question/13293425
The complete question is:
Select all the reactions in which the oxidation numbers of the reactant species change, that is, are redox reactions.
a) 7O₂ (g) + 2C₂H₆ (l) → 4CO₂ (g) + 6H₂O (l)
b) Co (s) + Cl₂ (g) → CoCl₂ (s)
c) Cu(OH)₂ (s) + 2HClO₄ (aq) → Cu(ClO₄)₂ (aq) + H₂O (l)
d) ZnBr₂ (aq) + 2KOH (aq) → Zn(OH)₂ (s) + 2KBr (aq)
#SPJ4
A 13.0 ml sample of an acid requires 37,3 ml of 0.303N NaOH for neutralization. Calculate the normality of the acid.
The amount of 0.303N NaOH needed to neutralize a 13.0 ml sample of acid is 37,3 ml. Acid is 0.823N normal, according to the standard.
Explain about the neutralization.The idea of neutralization, according to which an acid reacts with a base to create salt and water. By comparing the molarity of the base to the amount of base needed for neutralization, it is possible to calculate the molarity of the acid. Once the molarity and the acid's valence (or charge) have been multiplied, the acid's normalcy can be determined.
By deducting the volume of NaOH (37.3 ml) from the volume of the acid sample in Step 1, you can calculate the amount of acid that was utilized in the neutralization procedure (13.0 ml).
Consequently, 13.0 ml to 37.3 ml
= -24.3 ml
Use the equation moles = normality x volume to determine the number of moles of acid that were used in the process.
Consequently, moles equal 0.303N x -24.3 ml.
= -7.33 moles
Determine the acid's normality by multiplying the volume by the formula normalcy = moles.
As a result: normalcy = -7.33 moles / 13.0 ml
= -0.823N
To learn more about neutralization, visit
brainly.com/question/15347368
#SPJ1
rutherford's gold foil experiment was very important in developing the nuclear model of the atom. which of the following statements correctly describe the observations made and the implications of each for atomic structure? select all that apply. Most α particles passed straight through the foil, implying that the atom consists largely of empty space.-A few α particles showed major deflections, indicating the presence of a dense central core within the atom.
Experiments with cathode rays led Thomson to propose that the electron was a negatively charged particle.
What is meant by cathode ?
The positive terminal of a battery or other source of electrical energy via which electrons exit and the cathode, negative terminal or electrode through which they enter a direct current load, such as an electrolytic cell or an electron tube.The anode is the negative or reducing electrode that undergoes electrochemical reactions and delivers electrons to the external circuit while oxidising.The positive or oxidising electrode known as the cathode is decreased during the electrochemical process after receiving electrons from the external circuit.An x-ray tube's cathode serves to expel the electrons from the circuit and concentrate them in a beam on the anode's focal spot.To learn more about cathode refer to
https://brainly.com/question/29784733
#SPJ4
Ammonia is produced from the reaction of nitrogen and hydrogen according to the following balanced equation: N2(g) + 3H2(g) rightarrow 2NH3(g) What is the maximum mass of ammonia that can be produced from a mixture of 330.0 g of N2 and 420.0 g of H2? g Which element would be left partially unreacted? (enter nitrogen or hydrogen) What mass of the starting material would remain unreacted? g Look at how many grams of ammonia the N2 would produce and how many grams of ammonia the H2 would produce. Watch the mole ratios! Whichever produces the smallest amount of ammonia is the limiting reactant. HINT: After you have found which starting material was used up completely, you know that some of the other starting material is still unreacted. Subtract the reacted material (which you must calculate) from the original amount you had in the beginning, thus finding how much remains unreacted.
The maximum mass of ammonia that can be produced from a mixture of 330.0 g of N2 and 420.0 g of H2 is 400.7g. Hydrogen is left unreacted. The mass of the Hydrogen would remain unreacted is 349.3g.
What is the limiting reagent?A chemical reaction's limiting reagent is the one that will totally consume all of the reactants. The reaction cannot continue if that reactant is no longer present. It prevents the reaction from intensifying as a result.
The reactant with surplus reagent is the one that would have continued to react if the other had not been used up.
The limiting reactant is the one that is consumed first and establishes a maximum limit on the quantity of product(s) that can be produced.
Calculate the amount of each reactant present and compare it to the amount of each reactant in the balanced chemical equation to determine the limiting reactant.
1) Moles of N2=330/28=11.79
moles of H2=420/2=210
moles of NH3 formed=2*11.79=23.57moles = 400.7g
2) Hydrogen is left unreacted.
3) hydrogen left=210-11.79*3=174.64moles = 349.3g
Learn more about limiting reagent refer to ;
brainly.com/question/26905271
#SPJ4
balance the chemical reaction between citric acid and sodium hydrogen carbonate below after you complete the reaction?
H₃C₆H₅O₇ + 3NaHCO₃ → Na₃C₆H₅O₇ + 3H₂O + 3CO₂ is a balanced equation. In addition to carbon dioxide, the interaction.
The chemical reaction of citric acid and sodium bicarbonate creates sodium citrate and water. The following is the reaction:
H₃C₆H₅O₇ + 3NaHCO₃ → Na₃C₆H₅O₇ + 3H₂O + 3CO₂.
To draw its Lewis structure, we see that a hydrogen is bonded to a Sulphur, suggesting that there would be no hydrogen bonding, but the shape is curved, showing that Sulphur and hydrogen have different electronegativity. As a result, this is a polar molecule with dipole-dipole as the most powerful force. The following molecule is non-polar and consists of only two atoms. Chemical reaction between citric acid and sodium hydrogen carbonate below after you complete the reaction.
learn more about Lewis structure here:
brainly.com/question/20300458
#SPJ4
The complete question is:
Balance the chemical reaction between citric acid and sodium hydrogen carbonate below after you complete the reaction?
H₃C₆H₅O₇ + NaHCO₃ → Na₃C₆H₅O₇ + H₂O + CO₂
Factors that affect the rate of a chemical reaction include which of the following? I. Frequency of collisions of reactant particles II. Kinetic energy of collisions of reactant particles III. Orientation of reactant particles during collisions a. I and Il only 0 b. I, Il, and Ill c. Il and IIl only d. Il only e. I and Ill only
Some elements that impact a chemical reaction's pace are collisions between reactant particles have kinetic energy.
What are the factors affecting the chemical reaction?Two or more molecules colliding with the proper energy and orientation to create a new chemical compound is known as a chemical reaction. It should be possible to maintain the reaction's whole mass. Chemical reactions come in a wide variety of forms, such as double displacement reactions and combination reactions.
There are a multitude of variables that might influence a reaction's rate, and one of these is the kinetic energy of reactant particle collisions. Chemical reaction rates are inversely correlated with reaction rates. Five variables have been identified as having an impact on chemical reaction rates: the reactants' state of subdivision (one big lump versus many little particles), the chemical composition of the reacting substances,
Therefore the correct answer is option d ) Il only
To learn more about chemical reaction refer to :
https://brainly.com/question/25913856
#SPJ4
Select, from the following dienophiles, all that would be more reactive than ethylene in a Diels-Alder reaction.
A, C, and D are dienophiles that would be more reactive than ethylene in a Diels-Alder process. Electron-drawing groups on the dienophile in general.
hasten Diels-Alder reactions (diene lover). Ethylene reacts slowly in a Diels-Alder reaction, whereas propenal, ethyl propenoate, and the other chemicals listed below are quite reactive. In the Diels-Alder reaction, a diene reacts with a pi bond (often referred to as a "dienophile") to generate a new six-membered ring. Two C-C sigma bonds and a C-C (pi) bond are formed, whereas three C-C pi bonds are broken. All of the following dienophiles are more reactive than ethylene in a Diels-Alder synthesis. A, C, and D are dienophiles that are more reactive than ethylene in a Diels-Alder reaction.
learn more about Diels-Alder here:
https://brainly.com/question/29972519
#SPJ4
does the frequency of the electromagnetic radiation released when excited electrons return to ground state rely on which orbits ?
Frequency of the electromagnetic radiation wavelength excited electrons return to ground state rely on which orbits.
What is meant by electromagnetic ?
The electromagnetic force that exists between electrically charged particles is the subject of the branch of physics known as electromagnetism.One of the four fundamental forces, the electromagnetic force, manifests electromagnetic fields like magnetic fields, electric fields, and light.Radio and television waves, microwaves, infrared rays, visible light, ultraviolet light, X-rays, and gamma rays are all examples of electromagnetic waves that propagate across space independently of matter.They are all referred to as electromagnetic radiation by scientists. Since the electric and magnetic fields are oscillating, the waves of energy are known as electromagnetic (EM). They are categorized by scientists based on their frequency or wavelength, from high frequency to low frequency.To learn more about electromagnetic refer to
https://brainly.com/question/25847009
#SPJ4
The pH of an aqueous solution is defined as the negative of the logarithm of the concentration of H ion in the solution:
pH-log[H Compute the pH of the solution if the concentration of H ion is 0.02 moles per liter Select one: A. 1.05 B. 2.7 C. 0.95 D. 1.7 E. 0.7
The pH of an aqueous solution is defined as the negative of the logarithm of the concentration of H ion in the solution is 0.7 .
What is meant by logarithm ?
The logarithm is exponentiation's opposite function in mathematics.This indicates that the exponent to which b must be raised in order to obtain a number x is the logarithm of x to the base b.John Napier developed logarithms in 1614 as a way to make calculations easier.They were quickly adopted by surveyors, engineers, scientists, and navigators to make high-accuracy calculations simpler.Logarithm tables allow for the simple addition and table lookup of arduous multi-digit multiplication processes.The exponential function and the letter e were both introduced by Leonhard Euler in the 18th century, who also gave us the idea of logarithms as we know them today.To learn more about logarithm refer to
https://brainly.com/question/25710806
#SPJ4
water molecules form hydrogen bonds between each others. hydrogen bonds are: (select all that apply) (check all that apply)
Water molecules form hydrogen bonds between each others. Hydrogen bonds are Non - Covalent bond. Hence the correct option is (b).
Hydrogen bonds are a type of non-covalent bond that form between electronegative atoms, such as nitrogen, oxygen, or fluorine, and hydrogen atoms that are covalently bonded to these electronegative atoms. In water molecules, hydrogen bonds form between the partially positive hydrogen atoms of one water molecule and the partially negative oxygen atoms of another water molecule. Hydrogen bonds are relatively weak compared to covalent bonds, but they play a crucial role in determining the properties of water and many other biologically important molecules. For example, the hydrogen bonds between water molecules are responsible for the high boiling point and low vapor pressure of water, as well as its high surface tension. Hydrogen bonds also play a key role in stabilizing the shape and function of proteins, DNA, and RNA, as well as in mediating the interactions between these biological molecules. Overall, hydrogen bonds are a unique type of non-covalent interaction that are essential for the stability and function of many important biological and chemical systems.
To know more about hydrogen bonds please refer: https://brainly.com/question/21220768
#SPJ4
Question - Water molecules form hydrogen bonds between each others. hydrogen bonds are_____. Select the correct option from the following:-
(a) Covalent bond
(b) Non - Covalent bond
(c) Ionic bond
(d) Polar bond
in question 19, we said intermolecular forces would cause pressure to be than predicted. is this observed in model 3?
Molecules should collide at a smaller volume, the pressure actually applied will be higher than that which was expected.
The phrase "intermolecular forces," or "IMF," refers to the attractive and repulsive forces that form between the molecules of a substance. Through the use of these forces, certain molecules of a substance communicate with one another. Most of the physical and chemical features of matter are caused by intermolecular forces. Pressure is created when gas molecules slam into the container's walls. The elastic bombardment of moving molecules on the walls is what causes this pressure, according to the kinetic theory of gases. Because molecules should collide at a smaller volume, the pressure actually applied will be higher than that which was expected.
Learn more about intermolecular forces from here:
https://brainly.com/question/9007693
#SPJ4
ph-dependent; a small change in ph produces a large change in the rate of the process. this is true not only for the many reactions in which the ion is a direct participant, but also for those reactions in which there is no apparent role for ions. the enzymes that catalyze cellular reactions, and many of the molecules on which they act, contain ionizable groups with characteristic values. the protonated amino and carboxyl groups of amino acids and the phosphate groups of nucleotides, for example, function as weak acids; their ionic state is determined by the ph of the surrounding medium.
when the ph of the medium changes, the ionization state of the active groups of the enzyme and its substrate also change, thus altering the rate of the reaction.
What is reaction?A response is an action that is made in response to an event. It can be physical, mental, or emotional in nature, and can range from positive to negative. Reaction can be used to express feelings such as joy, surprise, anger, disappointment, and even fear. It is most commonly seen in social situations, where people respond to one another and the environment around them. Reactions can also be seen in animals and other organisms, as they respond to their environment in order to survive. Reactions can help us to understand ourselves and the world around us, and can help us to make decisions and take actions.
To learn more about Reaction
https://brainly.com/question/24795637
#SPJ4
When limestone is heated during Step 1, an equilibrium is established. Which of the following expressions is the equilibrium constant for the decomposition of limestone?
A.
[CaO]
B.
[CaCO3]
C.
[CO2]
D.
[CaO] × [CaCO3]
The decomposition of limestone is the reaction of calcium carbonate (CaCO3) with heat to form calcium oxide (CaO) and carbon dioxide (CO2).
The equilibrium constant for a reaction is typically represented by a specific symbol, such as Kc or Kp, and is a measure of the relative concentrations of the reactants and products at equilibrium.The equilibrium constant for the decomposition of limestone is represented by Kc and is the product of the concentrations of the products raised to their stoichiometric coefficients, divided by the product of the concentrations of the reactants raised to their stoichiometric coefficients. Kc = [CaO] * [CO2] / [CaCO3]. Therefore the correct answer is D. [CaO] × [CaCO3]
To learn more about decomposition of limestone here:
https://brainly.com/question/28302884
#SPJ4
g compound a, c8h10, absorbed 3 equivalents of h2 on catalytic hydrogenation over a pd/c catalyst to give b (c8h16). on ozonolysis, compound a gave, among other things, a ketone which was identified as cyclopentanone. on treatment with nanh2 in nh3, followed by addition of iodomethane, compound a gave a new hydrocarbon, c (c9h12).
On catalytic hydrogenation, molecule A C8H10 absorbed three equivalents of H2, which indicates that it either possesses one double bond and one triple bonds or three double bonds.
Over a Pd/C catalyst, compound A, C8H10, underwent catalytic hydrogenation and absorbed three equivalents of H2 to generate compound B. (C8H16). Ozonolysis of compound A resulted in the production of many compounds, including the ketone cyclopentanone. Compound A was treated with NaNH2 in NH3, and then iodomethane was added, resulting in the production of a new hydrocarbon, C. (C9H12).
The given chemical A C8H10 has an unsaturation level of
[tex]DU= (Cn+1)-Hn/2 -Xn/2 +Nn/2[/tex]
[tex]DU = (8+1)-10/2[/tex]
[tex]DU = 4[/tex]
The given chemical thus either has four double bonds, four rings, or three double bonds and a ring.
To learn more about ozonolysis click here https://brainly.com/question/13580842
#SPJ4
complete question: Compound A, C8H10, absorbed 3 equivalents of H2 on catalytic hydrogenation over a Pd/C catalyst to give B (C8H16). On ozonolysis, compound A gave, among other things, a ketone which was identified as cyclopentanone. On treatment with NaNH2 in NH3, followed by addition of iodomethane, compound A gave a new hydrocarbon, C (C9H12). Draw the structure of Compound A and Compound B.
Correctly order the steps necessary to solve for the mass of a product, or second reactant required, given the mass of one of the reactants in a chemical process. Start with the first step at the top of the list. Place these in the proper order. O Convert the given mass into moles using molar mass. Convert moles of A to moles of B using a conversion factor derived from the balanced equation O Convert the moles of the second substance to mass using its molar mass. O Write a balanced equation for the reaction.
The correct sequence in this case would be-
Each organ system directly contributes to 1. For the reaction, write a balanced equation. Use molar mass to convert the given mass into moles.Use a conversion factor derived from the balanced equation to change moles of A into moles of B. Using the second substance's molar mass, convert the second substance's moles to mass.In terms of size and mass, molecules and atoms are incredibly small. The weight of one sample mole is known as the molar mass. The molar mass is determined by adding the atomic masses (atomic weights) of each atom in the molecule. Use the mass listed in the Periodic Table or Atomic Weight Table to determine the atomic mass for each element.To calculate the molecular mass, multiply the subscript (number of atoms) by the atomic mass of the relevant element and add the masses of all the other elements in the molecule. Typically, molar mass is expressed in either grams (g) or kilograms (kg). The amount of atoms in one mole of the 12C isotope is equal to the amount of particles in 12g (0.012 kg) of the substance. one of the most crucialTo know more about molar mass here
https://brainly.com/question/24236159
#SPJ4
(2) The student adds some dilute nitric acid to a burette and does the titration. The equation for the reaction is Ba(OH)₂ + 2HNO, → Ba(NO₂)₂ + 2H₂O The student finds that 21.50 cm' of nitric acid of concentration 0.600 mol/dm³ neutralises 25.0 cm³ of barium hydroxide solution. Calculate the concentration, in mol/dm³, of the barium hydroxide solution.
Answer:
0.0964, I worked out the moles of barium hydroxide and divided this by two and then divided that by the volume of nitric acid
Explanation:
Answer:
0.258 mol/dm3
Explanation:
Ba(OH)2 + 2HNO3 ---------> Ba(NO2)2 +2H2O
1 : 2 : 1 : 2
0.00645 : 0.0129 : 0.00645 : 0.0129
Moles of Nitric Acid
Moles=Concentration X Volume(dm3)
0.600 X 0.0215
=0.0129 mol
Concentration= Moles/ Volume(dm3)
0.00645/0.025
= 0.258 mol/dm3
A prescription medication requires 8.00 mg per kg of body weight . Express your answer to three significant figures.
A prescription medication requires 8.00 mg per kg of body weight . The 0.017 grams is required per pound of the body weight. 1.7 × 10⁻² grams is required per pound of the body weight.
What is significant figure ?The term significant figure is defined as the number of digits in a value, often a measurement, that contribute to the degree of accuracy of the value.
We are given:
Medication requirement = 5.98 mg/kg
To convert the given amount in grams per pounds, we use the conversion factor:
1 kg = 2.20462 lb
1 g = 1000 mg
Converting the value into grams per pounds, we get:
= 8 mg / kg × 1g / 1000mg × 2.20462 lb / 1kg
= 0.017 grams
Thus, 1.7 × 10⁻² grams is required per pound of the body weight.
To learn more about the significant figure, follow the link;
https://brainly.com/question/29153641
#SPJ1
ions of which metal would be excpected to have the strongest interactions with water molecules in aqueous solutions
In aqueous solutions, ions of metals that are highly reactive and have a high charge density (such as those in the Group 1 or Group 2 of the periodic table) would be expected to have the strongest interactions with water molecules.
These metals have a high tendency to lose electrons and form cations, which can interact with the polar water molecules through electrostatic forces, such as hydrogen bonding.For example, ions of sodium (Na+), potassium (K+), calcium (Ca2+), and magnesium (Mg2+) are highly reactive and have high charge densities, and they would be expected to have strong interactions with water molecules in aqueous solutions. These ions are easily dissolved in water and form hydrated ions, which are surrounded by a "shell" of water molecules.In general, ions with a high charge to radius ratio will form stronger bonds with water molecules, so positively charged ions from the left side of the periodic table tend to be more hydrated.
Learn more about hydrogen bonding here:
https://brainly.com/question/15099999
#SPJ4
At a certain temperature the vapor pressure of pure chloroform (CHCI3) is measured to be 264. torr. Suppose a solution is prepared by mixing 82.9 g of chloroform and 62.9 g of heptane (C7H16). Calculate the partial pressure of chloroform vapor above this solution. Round your answer to 3 significant digits.
To determine the partial pressure of chloroform vapor, we can use Raoult's law. According to Raoult's law, a component's partial pressure in a solution is equal to its vapor pressure.
What does Raoult's law entail?
According to Raoult's law, a component's partial vapor pressure in a solution is equal to the vapor pressure of the pure component times the mole fraction present in the solution. Ideal solutions, which are those made up of volatile, unrelated molecules, are those that fall under the purview of this law. The total of the partial vapor pressures of the solution's constituent parts determines its vapor pressure. The ideal solution theory, which is based on Raoult's law, states that the vaporTo learn more about Raoult's law
brainly.com/question/9720507
#SPJ4
Which of the following compounds are the same?
Compound 1: 1.10 g of H and 8.90 g of O.
Compound 2: 4.95 g of H and 40.05 g of O.
Compound 3: 2.10 g of H and 32.90 g of O.
Compound 4: 4.70 g of H and 60.30 g of O
A. Compounds 1 and 4
B. Compounds 2 and 4
C. Compounds 2 and 3
D. Compounds 1 and 2
The following includes compounds 2 and 4 that are identical. In chemistry, a compound is a substance that is produced when two or more distinct chemical elements are combined in a particular order.
what are the different types of compounds?Salts and molecular compounds are the two main categories of chemicals. Covalent bonds are the means through which atoms in molecular compounds are joined. It is connected by ionic bonds in salts. All compounds are composed of these two different sorts of bonds.
Compounds are what kind of things?(KOM-pownd) A substance in science that is created through the chemical joining of two or more distinct elements Table salt (NaCl), which is a compound comprised of the elements sodium and chloride, and water (H2O), which are examples of compounds.
To know more about compounds visit:-
https://brainly.com/question/30037191
#SPJ1
Give the coordination number and charge of the central metal ion of the complex cation and then, separately, the complex anion in the coordination compound [cr(nh3)6][cr(cn)6].Give a systematic name for the following formula: [cr(nh3)6][cr(cn)6]
The coordination number and charge of the central metal ion of the complex cation [Cr(NH3)6]3+ in the coordination compound [Cr(NH3)6][Cr(CN)6] is 6 and 3+ respectively.
The coordination compound [Cr(NH3)6][Cr(CN)6] is composed of two ions: the complex cation [Cr(NH3)6]3+ and the complex anion [Cr(CN)6]4-. The complex cation [Cr(NH3)6]3+ is formed by the central metal ion, chromium (Cr), and six ammonia (NH3) molecules. The coordination number of the central metal ion in this complex cation is 6, which means it has six ligands (NH3) surrounding it. The charge of the central metal ion in this complex cation is 3+, which means it has lost 3 electrons. The complex anion [Cr(CN)6]4- is formed by the central metal ion, chromium (Cr), and six cyanide (CN) molecules. The coordination number of the central metal ion in this complex anion is 6, which means it has six ligands (CN) surrounding it. The charge of the central metal ion in this complex anion is 4-, which means it has gained 4 electrons. The systematic name for the formula [Cr(NH3)6][Cr(CN)6] is hexaamminochromium(III) hexacyanochromate(IV).
learn more about cation here:
brainly.com/question/1333307
#SPJ4
Zinc reacts with hydrochloric acid according to the following equation: Zn(s) + 2HCl(aq) → ZnCl2(aq) + H2(g) In a certain experiment, a 3.77 g sample of impure zinc is reacted with excess hydrochloric acid. If 1.09 L of H2 gas is collected at STP, what percentage of the original sample was zinc? Assume that the impurities do not react with HCl.
Answer:
approximately 69.24% of the original sample was zinc.
Explanation:
According to the equation, 1 mole of zinc reacts with 2 moles of HCl to produce 1 mole of ZnCl2 and 1 mole of H2.
We can use the Ideal Gas Law PV = nRT to find out the number of moles of H2 produced. Given that the pressure P = 1atm and temperature T = 273K (STP).
n = PV / RT = (1.09L) * (1atm) / (8.314J/mol * 273K) = 0.04 moles
Now we know that 0.04 moles of H2 is produced, we can use the balanced equation to find out the number of moles of zinc that reacted.
0.04 moles H2 is produced for every 1 mole of Zn.
thus 0.04 moles of zinc reacted.
The mass of zinc that reacted can be calculated by multiplying the number of moles by the molar mass of zinc (65.38g/mol)
0.04 moles * 65.38 g/mol = 2.6152 g
Now we can calculate the percentage of zinc in the original sample using the following equation:
% zinc = (mass of zinc reacted / mass of original sample) * 100
= (2.6152g / 3.77g) * 100 = 69.24%
So approximately 69.24% of the original sample was zinc.
Suppose you place 3.85 mL of a substance into a graduated cylinder. The graduated cylinder has a mass of 12.55 g when empty and a mass of 14.75 g after adding the substance.
What is the density of the substance (in g/mL)?
Type answer:
The density of the substance placed into the graduating cylinder is 0.571g/mL.
How to calculate density?Density is the measurement of the amount of mass per unit of volume. In order to calculate density, you need to know the mass and volume of the item. The formula for density is:
density = mass/volume
According to this question, 3.85 mL of a substance is placed into a graduated cylinder. The graduated cylinder has a mass of 12.55 g when empty and a mass of 14.75 g after adding the substance.
Mass of substance = 14.75g - 12.55g = 2.2g
Density of the substance = 2.2g ÷ 3.85mL = 0.571g/mL.
Therefore, 0.571g/mL is the density of the substance.
Learn more about density at: https://brainly.com/question/29775886
#SPJ1
medication order reads: rocephin 0.7 g im q 12 h. supply on hand: rocephin 1 g, reconstitute the 1 g vial by adding 2.1 ml of sterile water for injection. yields 350 mg/ml. give ml
A doctor issues a prescription for a drug to be taken and writes a prescription order.
What are the 4 different orders for prescription drugs?Medication orders can be divided into four categories: standing orders, single orders, standing orders, and prn orders.
A doctor issues a prescription for a drug to be taken and writes a prescription order. A nurse cannot deliver drugs without a prescription. Before a prescription may be filled, some details must be included in the prescription order.
Generally speaking, a medicine "order" is viewed of as an inpatient medication request, whereas a prescription is thought of as an outpatient medication request. A nurse may typically give a patient an order, while a prescription is something they can complete at the pharmacy.
To learn more about prescription order refer to:
https://brainly.com/question/28163123
#SPJ4
ATP is produced in some of the steps of the glycolytic pathway. For the reactions shown, which produce ATP?
a. Phosphoenolpyruvate → pyruvate
b. 1,3-biphosphoglycerate → 3-phosphoglycerate
c. glyceraldehyde 3-phosphate → 1,3-bisphosphoglycerate
d. Phosphoenolpyruvate → glyceraldehyde 3-phosphate
The glycolytic process includes some phases where ATP is created. ATP is created from phosphoenolpyruvate.
b. 1,3-biphosphoglycerate → 3-phosphoglycerate - Produces 1 ATP
d. Phosphoenolpyruvate → glyceraldehyde 3-phosphate - Produces 1 ATP
During which steps of glycolysis is ATP produced?
The final product of glycolysis is pyruvate, which is then converted into energy and two ATPs (Glucose + two NAD+, two ADP, and two pi = two pyruvate, two NADH, two H+, two ATP, and two molecules of water). In order to phosphorylate, the hydroxyl groups are necessary.
Glycolysis uses glucose 6-phosphate as a particular type of glucose.
The glycolytic process includes some phases where ATP is created. ATP is created from phosphoenolpyruvate.
At the end of glycolysis, one glucose molecule produces four ATP molecules. There is a net gain of 2 ATP molecules as 2 ATP molecules are lost during the first stage of glycolysis. The creation of two NADH molecules occurs as a side effect of glycolysis.
To learn more about glycolytic process refer to:
brainly.com/question/1966268
#SPJ4
the atomic mass unit is a standardized unit defined as exactly 112 the mass of a(n) -12 atom. the atomic mass (weight) of any element is determined relative to this standard and is not a whole number, since it is a(n) of the masses of its naturally occurring isotopes.
The atomic mass of an element is the total number of protons and the neutrons in a particular atom of the element.
The atomic mass unit is a standardized unit and defined as the exactly 1 / 12 the mass of a carbon -12 atom. The atomic mass or weight of any element is determined by the relative to this standard and is not a whole number, since it is an average of the masses of its naturally occurring isotopes.
The atomic mass of an element is total number of protons and the neutrons. The atomic mass is average weight of all the isotopes of that element.
To learn more about atomic mass here
https://brainly.com/question/16887530
#SPJ4
